C16H21NO3S2 — CID 54508077
(2S)-1-[3-(2-phenylethyldisulfanyl)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54508077) has the molecular formula C16H21NO3S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (2S)-1-[3-(2-phenylethyldisulfanyl)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-(2-phenylethyldisulfanyl)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54508077 |
| Molecular Formula | C16H21NO3S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2S)-1-[3-(2-phenylethyldisulfanyl)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)CCSSCCc1ccccc1 |
| InChI | InChI=1S/C16H21NO3S2/c18-15(17-10-4-7-14(17)16(19)20)9-12-22-21-11-8-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | YHDATNJAKBUCAI-AWEZNQCLSA-N |
| XLogP | 3.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|