C16H21NO3Se — CID 22809670
(2S)-1-(4-benzylselanylbutanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 22809670) has the molecular formula C16H21NO3Se and a molecular weight of 354.31 g/mol. Its IUPAC name is (2S)-1-(4-benzylselanylbutanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(4-benzylselanylbutanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22809670 |
| Molecular Formula | C16H21NO3Se |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (2S)-1-(4-benzylselanylbutanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)CCC[Se]Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO3Se/c18-15(17-10-4-8-14(17)16(19)20)9-5-11-21-12-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | INSGDSONAHFTIY-AWEZNQCLSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|