C15H17NO4Se — CID 22809669
(2S)-1-(3-benzoylselanylpropanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 22809669) has the molecular formula C15H17NO4Se and a molecular weight of 354.26 g/mol. Its IUPAC name is (2S)-1-(3-benzoylselanylpropanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(3-benzoylselanylpropanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22809669 |
| Molecular Formula | C15H17NO4Se |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | (2S)-1-(3-benzoylselanylpropanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C([Se]CCC(=O)N1CCC[C@H]1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H17NO4Se/c17-13(16-9-4-7-12(16)14(18)19)8-10-21-15(20)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | DMMJHCVHMAJVBJ-LBPRGKRZSA-N |
| XLogP | 1.41 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|