About S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate
S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate (PubChem CID 143667740) has the molecular formula C15H22O2S2
and a molecular weight of 298.47 g/mol. Its IUPAC name is S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate.
Molecular Properties
| Compound Name | S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate |
| PubChem CID | 143667740 |
| Molecular Formula | C15H22O2S2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate |
| SMILES | CCOSC[C@@H](C)CCCSC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O2S2/c1-3-17-19-12-13(2)8-7-11-18-15(16)14-9-5-4-6-10-14/h4-6,9-10,13H,3,7-8,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | AQLSBAAHQCXQAP-ZDUSSCGKSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate?
The IUPAC name of S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate (CID 143667740) is S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate.
What is the SMILES notation for S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate?
The canonical SMILES for S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate is CCOSC[C@@H](C)CCCSC(=O)c1ccccc1.
What is the InChIKey of S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate?
The InChIKey is AQLSBAAHQCXQAP-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H22O2S2/c1-3-17-19-12-13(2)8-7-11-18-15(16)14-9-5-4-6-10-14/h4-6,9-10,13H,3,7-8,11-12H2,1-2H3/t13-/m0/s1.
What are the key properties of S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate?
S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate has a molecular weight of 298.47 g/mol, XLogP of 4.66, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(4S)-5-ethoxysulfanyl-4-methylpentyl] benzenecarbothioate is sourced from PubChem (CID 143667740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).