About S-ethoxy benzenecarbothioate
S-ethoxy benzenecarbothioate (PubChem CID 24974062) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is S-ethoxy benzenecarbothioate.
Molecular Properties
| Compound Name | S-ethoxy benzenecarbothioate |
| PubChem CID | 24974062 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | S-ethoxy benzenecarbothioate |
| SMILES | CCOSC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H10O2S/c1-2-11-12-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | IZXYOXOFDQSMSZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethoxy benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethoxy benzenecarbothioate?
The IUPAC name of S-ethoxy benzenecarbothioate (CID 24974062) is S-ethoxy benzenecarbothioate.
What is the SMILES notation for S-ethoxy benzenecarbothioate?
The canonical SMILES for S-ethoxy benzenecarbothioate is CCOSC(=O)c1ccccc1.
What is the InChIKey of S-ethoxy benzenecarbothioate?
The InChIKey is IZXYOXOFDQSMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c1-2-11-12-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3.
What are the key properties of S-ethoxy benzenecarbothioate?
S-ethoxy benzenecarbothioate has a molecular weight of 182.24 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethoxy benzenecarbothioate is sourced from PubChem (CID 24974062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).