C30H34O6 — CID 175347135
2-[1,3-bis(oxiran-2-yl)-2-(oxiran-2-ylmethyl)propan-2-yl]-1,3-bis(2-methylphenyl)-2-(oxiran-2-ylmethyl)propane-1,3-dione (PubChem CID 175347135) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-[1,3-bis(oxiran-2-yl)-2-(oxiran-2-ylmethyl)propan-2-yl]-1,3-bis(2-methylphenyl)-2-(oxiran-2-ylmethyl)propane-1,3-dione.
| Compound Name | 2-[1,3-bis(oxiran-2-yl)-2-(oxiran-2-ylmethyl)propan-2-yl]-1,3-bis(2-methylphenyl)-2-(oxiran-2-ylmethyl)propane-1,3-dione |
|---|---|
| PubChem CID | 175347135 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 2-[1,3-bis(oxiran-2-yl)-2-(oxiran-2-ylmethyl)propan-2-yl]-1,3-bis(2-methylphenyl)-2-(oxiran-2-ylmethyl)propane-1,3-dione |
| SMILES | Cc1ccccc1C(=O)C(CC1CO1)(C(=O)c1ccccc1C)C(CC1CO1)(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C30H34O6/c1-19-7-3-5-9-25(19)27(31)30(14-24-18-36-24,28(32)26-10-6-4-8-20(26)2)29(11-21-15-33-21,12-22-16-34-22)13-23-17-35-23/h3-10,21-24H,11-18H2,1-2H3 |
| InChIKey | MTFDAYJTKZITBT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|