C22H22O6 — CID 167745304
[(3S,3aR,6R,6aR)-6-(2-methylbenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-methylbenzoate (PubChem CID 167745304) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-6-(2-methylbenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-methylbenzoate.
| Compound Name | [(3S,3aR,6R,6aR)-6-(2-methylbenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-methylbenzoate |
|---|---|
| PubChem CID | 167745304 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [(3S,3aR,6R,6aR)-6-(2-methylbenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)c1ccccc1C |
| InChI | InChI=1S/C22H22O6/c1-13-7-3-5-9-15(13)21(23)27-17-11-25-20-18(12-26-19(17)20)28-22(24)16-10-6-4-8-14(16)2/h3-10,17-20H,11-12H2,1-2H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | JHBNXIOQNINHCU-IYWMVGAKSA-N |
| XLogP | 2.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |