C20H20O8 — CID 118173862
[(3S,3aR,6R,6aR)-3-carboxyoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] hydrogen carbonate;1,1'-biphenyl (PubChem CID 118173862) has the molecular formula C20H20O8 and a molecular weight of 388.37 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-3-carboxyoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] hydrogen carbonate;1,1'-biphenyl.
| Compound Name | [(3S,3aR,6R,6aR)-3-carboxyoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] hydrogen carbonate;1,1'-biphenyl |
|---|---|
| PubChem CID | 118173862 |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [(3S,3aR,6R,6aR)-3-carboxyoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] hydrogen carbonate;1,1'-biphenyl |
| SMILES | O=C(O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H10O8/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-7(10)15-3-1-13-6-4(16-8(11)12)2-14-5(3)6/h1-10H;3-6H,1-2H2,(H,9,10)(H,11,12)/t;3-,4+,5-,6-/m.1/s1 |
| InChIKey | RWRGLSALXWAAIF-VCDGYCQFSA-N |
| XLogP | 3.26 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |