C12H14O4 — CID 22808602
(3R,3aR,6S,6aR)-6-phenoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 22808602) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (3R,3aR,6S,6aR)-6-phenoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6S,6aR)-6-phenoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 22808602 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (3R,3aR,6S,6aR)-6-phenoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2Oc1ccccc1 |
| InChI | InChI=1S/C12H14O4/c13-9-6-14-12-10(7-15-11(9)12)16-8-4-2-1-3-5-8/h1-5,9-13H,6-7H2/t9-,10+,11-,12-/m1/s1 |
| InChIKey | GBCOBODHPUMBLK-WRWGMCAJSA-N |
| XLogP | 0.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |