C19H21BO6 — CID 170790262
[4-[[(3R,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]phenyl]boronic acid (PubChem CID 170790262) has the molecular formula C19H21BO6 and a molecular weight of 356.18 g/mol. Its IUPAC name is [4-[[(3R,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]phenyl]boronic acid.
| Compound Name | [4-[[(3R,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 170790262 |
| Molecular Formula | C19H21BO6 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [4-[[(3R,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H21BO6/c21-20(22)14-6-8-15(9-7-14)26-17-12-25-18-16(11-24-19(17)18)23-10-13-4-2-1-3-5-13/h1-9,16-19,21-22H,10-12H2/t16-,17-,18-,19-/m1/s1 |
| InChIKey | TZFCPTXNZCDDMT-NCXUSEDFSA-N |
| XLogP | 0.50 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|