C16H20O4 — CID 11033116
(3R,3aR,6R,6aR)-3-phenylmethoxy-6-[(Z)-prop-1-enoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 11033116) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-3-phenylmethoxy-6-[(Z)-prop-1-enoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3R,3aR,6R,6aR)-3-phenylmethoxy-6-[(Z)-prop-1-enoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 11033116 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3R,3aR,6R,6aR)-3-phenylmethoxy-6-[(Z)-prop-1-enoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C/C=C\O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C16H20O4/c1-2-8-17-13-10-19-16-14(11-20-15(13)16)18-9-12-6-4-3-5-7-12/h2-8,13-16H,9-11H2,1H3/b8-2-/t13-,14-,15-,16-/m1/s1 |
| InChIKey | YVZGKCPVEZBNRR-VJCCIKRCSA-N |
| XLogP | 2.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|