C17H21N2O3+ — CID 101489530
1-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-methylimidazol-3-ium (PubChem CID 101489530) has the molecular formula C17H21N2O3+ and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-methylimidazol-3-ium.
| Compound Name | 1-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 101489530 |
| Molecular Formula | C17H21N2O3+ |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-methylimidazol-3-ium |
| SMILES | C[n+]1ccn([C@H]2CO[C@H]3[C@@H]2OC[C@H]3OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H21N2O3/c1-18-7-8-19(12-18)14-10-21-17-15(11-22-16(14)17)20-9-13-5-3-2-4-6-13/h2-8,12,14-17H,9-11H2,1H3/q+1/t14-,15+,16+,17+/m0/s1 |
| InChIKey | QASVDUYGDBCCEU-YLFCFFPRSA-N |
| XLogP | 1.24 |
| TPSA | 36.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|