C23H27N2O4+ — CID 90276914
[(2R,3R,4S,5R)-5-(3-methylimidazol-3-ium-1-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol (PubChem CID 90276914) has the molecular formula C23H27N2O4+ and a molecular weight of 395.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(3-methylimidazol-3-ium-1-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R)-5-(3-methylimidazol-3-ium-1-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 90276914 |
| Molecular Formula | C23H27N2O4+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(3-methylimidazol-3-ium-1-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
| SMILES | C[n+]1ccn([C@@H]2O[C@H](CO)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H27N2O4/c1-24-12-13-25(17-24)23-22(28-16-19-10-6-3-7-11-19)21(20(14-26)29-23)27-15-18-8-4-2-5-9-18/h2-13,17,20-23,26H,14-16H2,1H3/q+1/t20-,21-,22+,23-/m1/s1 |
| InChIKey | SJRJKAXLARFJHD-BXXSPATCSA-N |
| XLogP | 2.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|