C23H27ClN2O4 — CID 90276913
[(2R,3R,4S,5R)-5-(3-methylimidazol-3-ium-1-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol chloride (PubChem CID 90276913) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(3-methylimidazol-3-ium-1-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol chloride.
| Compound Name | [(2R,3R,4S,5R)-5-(3-methylimidazol-3-ium-1-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol chloride |
|---|---|
| PubChem CID | 90276913 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(3-methylimidazol-3-ium-1-yl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol chloride |
| SMILES | C[n+]1ccn([C@@H]2O[C@H](CO)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C23H27N2O4.ClH/c1-24-12-13-25(17-24)23-22(28-16-19-10-6-3-7-11-19)21(20(14-26)29-23)27-15-18-8-4-2-5-9-18;/h2-13,17,20-23,26H,14-16H2,1H3;1H/q+1;/p-1/t20-,21-,22+,23-;/m1./s1 |
| InChIKey | RDUKRQMYPFKDDE-IDWCSQIQSA-M |
| XLogP | -0.62 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|