C13H16O3 — CID 156643609
(3aR)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 156643609) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (3aR)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3aR)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 156643609 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (3aR)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | c1ccc(COC2CO[C@@H]3CCOC23)cc1 |
| InChI | InChI=1S/C13H16O3/c1-2-4-10(5-3-1)8-15-12-9-16-11-6-7-14-13(11)12/h1-5,11-13H,6-9H2/t11-,12?,13?/m1/s1 |
| InChIKey | PHFUIGMQLPUQTO-PNESKVBLSA-N |
| XLogP | 1.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |