C19H22O3 — CID 144869562
6-benzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;phenol (PubChem CID 144869562) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 6-benzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;phenol.
| Compound Name | 6-benzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;phenol |
|---|---|
| PubChem CID | 144869562 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 6-benzyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;phenol |
| SMILES | Oc1ccccc1.c1ccc(CC2COC3CCOC23)cc1 |
| InChI | InChI=1S/C13H16O2.C6H6O/c1-2-4-10(5-3-1)8-11-9-15-12-6-7-14-13(11)12;7-6-4-2-1-3-5-6/h1-5,11-13H,6-9H2;1-5,7H |
| InChIKey | IMAGXVIQGDDQHS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |