C17H24NO3+ — CID 11911705
[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(cyclopropylmethyl)azanium (PubChem CID 11911705) has the molecular formula C17H24NO3+ and a molecular weight of 290.38 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(cyclopropylmethyl)azanium.
| Compound Name | [(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(cyclopropylmethyl)azanium |
|---|---|
| PubChem CID | 11911705 |
| Molecular Formula | C17H24NO3+ |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | [(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(cyclopropylmethyl)azanium |
| SMILES | c1ccc(CO[C@@H]2CO[C@H]3[C@@H]2OC[C@@H]3[NH2+]CC2CC2)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-2-4-13(5-3-1)9-19-15-11-21-16-14(10-20-17(15)16)18-8-12-6-7-12/h1-5,12,14-18H,6-11H2/p+1/t14-,15+,16+,17+/m0/s1 |
| InChIKey | MQKWVQZGAABPIK-YLFCFFPRSA-O |
| XLogP | 0.71 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |