C22H25N2O3+ — CID 11911678
[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(1H-indol-3-ylmethyl)azanium (PubChem CID 11911678) has the molecular formula C22H25N2O3+ and a molecular weight of 365.45 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(1H-indol-3-ylmethyl)azanium.
| Compound Name | [(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(1H-indol-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 11911678 |
| Molecular Formula | C22H25N2O3+ |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | [(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(1H-indol-3-ylmethyl)azanium |
| SMILES | c1ccc(CO[C@@H]2CO[C@H]3[C@@H]2OC[C@@H]3[NH2+]Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-2-6-15(7-3-1)12-25-20-14-27-21-19(13-26-22(20)21)24-11-16-10-23-18-9-5-4-8-17(16)18/h1-10,19-24H,11-14H2/p+1/t19-,20+,21+,22+/m0/s1 |
| InChIKey | VJOFJZYXRJLHKU-DXBBTUNJSA-O |
| XLogP | 1.98 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |