C19H21NO8 — CID 169281449
(2,5-dioxopyrrolidin-1-yl) 2-[[(3R,3aR,6S,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate (PubChem CID 169281449) has the molecular formula C19H21NO8 and a molecular weight of 391.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[(3R,3aR,6S,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[(3R,3aR,6S,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 169281449 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[(3R,3aR,6S,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
| SMILES | O=C(CO[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccccc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H21NO8/c21-15-6-7-16(22)20(15)28-17(23)11-25-14-10-27-18-13(9-26-19(14)18)24-8-12-4-2-1-3-5-12/h1-5,13-14,18-19H,6-11H2/t13-,14+,18-,19-/m1/s1 |
| InChIKey | IIMIFTZWEBSIEX-GTYSZEQSSA-N |
| XLogP | 0.36 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|