C28H32NO3+ — CID 102210903
[(3S,3aR,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-dibenzyl-methylazanium (PubChem CID 102210903) has the molecular formula C28H32NO3+ and a molecular weight of 430.57 g/mol. Its IUPAC name is [(3S,3aR,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-dibenzyl-methylazanium.
| Compound Name | [(3S,3aR,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-dibenzyl-methylazanium |
|---|---|
| PubChem CID | 102210903 |
| Molecular Formula | C28H32NO3+ |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(3S,3aR,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-dibenzyl-methylazanium |
| SMILES | C[N+](Cc1ccccc1)(Cc1ccccc1)[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C28H32NO3/c1-29(17-22-11-5-2-6-12-22,18-23-13-7-3-8-14-23)25-20-31-28-26(21-32-27(25)28)30-19-24-15-9-4-10-16-24/h2-16,25-28H,17-21H2,1H3/q+1/t25-,26-,27+,28+/m0/s1 |
| InChIKey | RCHYFKWVFBPETM-YVHASNINSA-N |
| XLogP | 4.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|