C19H22N2O — CID 163609227
2-(1H-indol-3-yl)-N,N-dimethyl-1-phenylmethoxyethanamine (PubChem CID 163609227) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N,N-dimethyl-1-phenylmethoxyethanamine.
| Compound Name | 2-(1H-indol-3-yl)-N,N-dimethyl-1-phenylmethoxyethanamine |
|---|---|
| PubChem CID | 163609227 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(1H-indol-3-yl)-N,N-dimethyl-1-phenylmethoxyethanamine |
| SMILES | CN(C)C(Cc1c[nH]c2ccccc12)OCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-21(2)19(22-14-15-8-4-3-5-9-15)12-16-13-20-18-11-7-6-10-17(16)18/h3-11,13,19-20H,12,14H2,1-2H3 |
| InChIKey | HELUTFGNJXNTCA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|