C18H16N4O2 — CID 11209404
benzyl (2S)-2-azido-3-(1H-indol-3-yl)propanoate (PubChem CID 11209404) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is benzyl (2S)-2-azido-3-(1H-indol-3-yl)propanoate.
| Compound Name | benzyl (2S)-2-azido-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 11209404 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | benzyl (2S)-2-azido-3-(1H-indol-3-yl)propanoate |
| SMILES | [N-]=[N+]=N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H16N4O2/c19-22-21-17(18(23)24-12-13-6-2-1-3-7-13)10-14-11-20-16-9-5-4-8-15(14)16/h1-9,11,17,20H,10,12H2/t17-/m0/s1 |
| InChIKey | SFJXNGXACPQYJG-KRWDZBQOSA-N |
| XLogP | 4.13 |
| TPSA | 90.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|