C12H13N5O — CID 166796115
2-azido-3-(1H-indol-3-yl)-N-methylpropanamide (PubChem CID 166796115) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-azido-3-(1H-indol-3-yl)-N-methylpropanamide.
| Compound Name | 2-azido-3-(1H-indol-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 166796115 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-azido-3-(1H-indol-3-yl)-N-methylpropanamide |
| SMILES | CNC(=O)C(Cc1c[nH]c2ccccc12)N=[N+]=[N-] |
| InChI | InChI=1S/C12H13N5O/c1-14-12(18)11(16-17-13)6-8-7-15-10-5-3-2-4-9(8)10/h2-5,7,11,15H,6H2,1H3,(H,14,18) |
| InChIKey | KDTWMDKRRMUERQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|