C13H16N2OS — CID 175924820
(2S)-2-(ethylamino)-3-(1H-indol-3-yl)propanethioic S-acid (PubChem CID 175924820) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is (2S)-2-(ethylamino)-3-(1H-indol-3-yl)propanethioic S-acid.
| Compound Name | (2S)-2-(ethylamino)-3-(1H-indol-3-yl)propanethioic S-acid |
|---|---|
| PubChem CID | 175924820 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (2S)-2-(ethylamino)-3-(1H-indol-3-yl)propanethioic S-acid |
| SMILES | CCN[C@@H](Cc1c[nH]c2ccccc12)C(=O)S |
| InChI | InChI=1S/C13H16N2OS/c1-2-14-12(13(16)17)7-9-8-15-11-6-4-3-5-10(9)11/h3-6,8,12,14-15H,2,7H2,1H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | BHDOYESUEKRGQF-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|