C20H18O8 — CID 11338157
[(3S,3aR,6R,6aR)-3-phenoxycarbonyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] phenyl carbonate (PubChem CID 11338157) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-3-phenoxycarbonyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] phenyl carbonate.
| Compound Name | [(3S,3aR,6R,6aR)-3-phenoxycarbonyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] phenyl carbonate |
|---|---|
| PubChem CID | 11338157 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [(3S,3aR,6R,6aR)-3-phenoxycarbonyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] phenyl carbonate |
| SMILES | O=C(Oc1ccccc1)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H18O8/c21-19(25-13-7-3-1-4-8-13)27-15-11-23-18-16(12-24-17(15)18)28-20(22)26-14-9-5-2-6-10-14/h1-10,15-18H,11-12H2/t15-,16+,17-,18-/m1/s1 |
| InChIKey | JQGIDWQSPGEBBS-XMTFNYHQSA-N |
| XLogP | 2.95 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|