C16H14O4 — CID 54471598
3,4-dihydro-2H-chromen-2-yl phenyl carbonate (PubChem CID 54471598) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-2-yl phenyl carbonate.
| Compound Name | 3,4-dihydro-2H-chromen-2-yl phenyl carbonate |
|---|---|
| PubChem CID | 54471598 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3,4-dihydro-2H-chromen-2-yl phenyl carbonate |
| SMILES | O=C(Oc1ccccc1)OC1CCc2ccccc2O1 |
| InChI | InChI=1S/C16H14O4/c17-16(18-13-7-2-1-3-8-13)20-15-11-10-12-6-4-5-9-14(12)19-15/h1-9,15H,10-11H2 |
| InChIKey | XITBHZIIFJWBLX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|