3,4-dihydro-2H-chromen-2-yl phenyl carbonate

C16H14O4 — CID 54471598

IUPAC3,4-dihydro-2H-chromen-2-yl phenyl carbonate
SMILESO=C(Oc1ccccc1)OC1CCc2ccccc2O1
InChIInChI=1S/C16H14O4/c17-16(18-13-7-2-1-3-8-13)20-15-11-10-12-6-4-5-9-14(12)19-15/h1-9,15H,10-11H2
InChIKeyXITBHZIIFJWBLX-UHFFFAOYSA-N
MW270.28 g/mol
LogP3.55
Rot. Bonds2

About 3,4-dihydro-2H-chromen-2-yl phenyl carbonate

3,4-dihydro-2H-chromen-2-yl phenyl carbonate (PubChem CID 54471598) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-2-yl phenyl carbonate.

Molecular Properties

Compound Name3,4-dihydro-2H-chromen-2-yl phenyl carbonate
PubChem CID54471598
Molecular FormulaC16H14O4
Molecular Weight270.28 g/mol
Exact Mass270.09
IUPAC Name3,4-dihydro-2H-chromen-2-yl phenyl carbonate
SMILESO=C(Oc1ccccc1)OC1CCc2ccccc2O1
InChIInChI=1S/C16H14O4/c17-16(18-13-7-2-1-3-8-13)20-15-11-10-12-6-4-5-9-14(12)19-15/h1-9,15H,10-11H2
InChIKeyXITBHZIIFJWBLX-UHFFFAOYSA-N
XLogP3.55
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.28
LogP ≤ 53.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}

Analyze 3,4-dihydro-2H-chromen-2-yl phenyl carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dihydro-2H-chromen-2-yl phenyl carbonate?
The IUPAC name of 3,4-dihydro-2H-chromen-2-yl phenyl carbonate (CID 54471598) is 3,4-dihydro-2H-chromen-2-yl phenyl carbonate.
What is the SMILES notation for 3,4-dihydro-2H-chromen-2-yl phenyl carbonate?
The canonical SMILES for 3,4-dihydro-2H-chromen-2-yl phenyl carbonate is O=C(Oc1ccccc1)OC1CCc2ccccc2O1.
What is the InChIKey of 3,4-dihydro-2H-chromen-2-yl phenyl carbonate?
The InChIKey is XITBHZIIFJWBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4/c17-16(18-13-7-2-1-3-8-13)20-15-11-10-12-6-4-5-9-14(12)19-15/h1-9,15H,10-11H2.
What are the key properties of 3,4-dihydro-2H-chromen-2-yl phenyl carbonate?
3,4-dihydro-2H-chromen-2-yl phenyl carbonate has a molecular weight of 270.28 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-chromen-2-yl phenyl carbonate is sourced from PubChem (CID 54471598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).