C12H17NO3 — CID 154341753
1-amino-3-(3,4-dihydro-2H-chromen-2-yloxy)propan-2-ol (PubChem CID 154341753) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-amino-3-(3,4-dihydro-2H-chromen-2-yloxy)propan-2-ol.
| Compound Name | 1-amino-3-(3,4-dihydro-2H-chromen-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 154341753 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-amino-3-(3,4-dihydro-2H-chromen-2-yloxy)propan-2-ol |
| SMILES | NCC(O)COC1CCc2ccccc2O1 |
| InChI | InChI=1S/C12H17NO3/c13-7-10(14)8-15-12-6-5-9-3-1-2-4-11(9)16-12/h1-4,10,12,14H,5-8,13H2 |
| InChIKey | SBDNPKYGKKPWOO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |