C15H14O2 — CID 14668691
2-phenoxy-3,4-dihydro-2H-chromene (PubChem CID 14668691) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-phenoxy-3,4-dihydro-2H-chromene.
| Compound Name | 2-phenoxy-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 14668691 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-phenoxy-3,4-dihydro-2H-chromene |
| SMILES | c1ccc(OC2CCc3ccccc3O2)cc1 |
| InChI | InChI=1S/C15H14O2/c1-2-7-13(8-3-1)16-15-11-10-12-6-4-5-9-14(12)17-15/h1-9,15H,10-11H2 |
| InChIKey | PQBQIKJSCNFRRT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |