C14H18O3 — CID 139962317
2-(oxan-2-yloxy)-3,4-dihydro-2H-chromene (PubChem CID 139962317) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-(oxan-2-yloxy)-3,4-dihydro-2H-chromene.
| Compound Name | 2-(oxan-2-yloxy)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 139962317 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-(oxan-2-yloxy)-3,4-dihydro-2H-chromene |
| SMILES | c1ccc2c(c1)CCC(OC1CCCCO1)O2 |
| InChI | InChI=1S/C14H18O3/c1-2-6-12-11(5-1)8-9-14(16-12)17-13-7-3-4-10-15-13/h1-2,5-6,13-14H,3-4,7-10H2 |
| InChIKey | RNVQEEPKXPDTCG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |