C16H21NO4 — CID 175727284
(2S,3R)-3-methyl-N-[(2R)-oxan-2-yl]oxy-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 175727284) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (2S,3R)-3-methyl-N-[(2R)-oxan-2-yl]oxy-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2S,3R)-3-methyl-N-[(2R)-oxan-2-yl]oxy-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 175727284 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (2S,3R)-3-methyl-N-[(2R)-oxan-2-yl]oxy-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | C[C@@H]1Cc2ccccc2O[C@@H]1C(=O)NO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C16H21NO4/c1-11-10-12-6-2-3-7-13(12)20-15(11)16(18)17-21-14-8-4-5-9-19-14/h2-3,6-7,11,14-15H,4-5,8-10H2,1H3,(H,17,18)/t11-,14-,15+/m1/s1 |
| InChIKey | NRUIUNLUJGWHPI-DFBGVHRSSA-N |
| XLogP | 2.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|