C11H19NO4 — CID 97023842
(2R,3R)-3-methyl-N-[(2R)-oxan-2-yl]oxyoxolane-2-carboxamide (PubChem CID 97023842) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (2R,3R)-3-methyl-N-[(2R)-oxan-2-yl]oxyoxolane-2-carboxamide.
| Compound Name | (2R,3R)-3-methyl-N-[(2R)-oxan-2-yl]oxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 97023842 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (2R,3R)-3-methyl-N-[(2R)-oxan-2-yl]oxyoxolane-2-carboxamide |
| SMILES | C[C@@H]1CCO[C@H]1C(=O)NO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C11H19NO4/c1-8-5-7-15-10(8)11(13)12-16-9-4-2-3-6-14-9/h8-10H,2-7H2,1H3,(H,12,13)/t8-,9-,10-/m1/s1 |
| InChIKey | CFIQOEREQZWAGR-OPRDCNLKSA-N |
| XLogP | 0.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|