C12H22N2O5 — CID 19371750
1-methyl-1,3-bis(oxan-2-yloxy)urea (PubChem CID 19371750) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-methyl-1,3-bis(oxan-2-yloxy)urea.
| Compound Name | 1-methyl-1,3-bis(oxan-2-yloxy)urea |
|---|---|
| PubChem CID | 19371750 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-methyl-1,3-bis(oxan-2-yloxy)urea |
| SMILES | CN(OC1CCCCO1)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C12H22N2O5/c1-14(19-11-7-3-5-9-17-11)12(15)13-18-10-6-2-4-8-16-10/h10-11H,2-9H2,1H3,(H,13,15) |
| InChIKey | FOIUZSIGFCRJEN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|