C10H15Cl2NO3 — CID 94820955
(1R)-2,2-dichloro-1-methyl-N-[(2S)-oxan-2-yl]oxycyclopropane-1-carboxamide (PubChem CID 94820955) has the molecular formula C10H15Cl2NO3 and a molecular weight of 268.14 g/mol. Its IUPAC name is (1R)-2,2-dichloro-1-methyl-N-[(2S)-oxan-2-yl]oxycyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-1-methyl-N-[(2S)-oxan-2-yl]oxycyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94820955 |
| Molecular Formula | C10H15Cl2NO3 |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | (1R)-2,2-dichloro-1-methyl-N-[(2S)-oxan-2-yl]oxycyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)NO[C@H]2CCCCO2)CC1(Cl)Cl |
| InChI | InChI=1S/C10H15Cl2NO3/c1-9(6-10(9,11)12)8(14)13-16-7-4-2-3-5-15-7/h7H,2-6H2,1H3,(H,13,14)/t7-,9+/m0/s1 |
| InChIKey | PBQOPVGRSYAELR-IONNQARKSA-N |
| XLogP | 2.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|