C11H17NO4 — CID 154865294
(1R,5R)-N-(oxan-2-yloxy)-3-oxabicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 154865294) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (1R,5R)-N-(oxan-2-yloxy)-3-oxabicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1R,5R)-N-(oxan-2-yloxy)-3-oxabicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 154865294 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (1R,5R)-N-(oxan-2-yloxy)-3-oxabicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | O=C(NOC1CCCCO1)[C@@]12COC[C@@H]1C2 |
| InChI | InChI=1S/C11H17NO4/c13-10(11-5-8(11)6-14-7-11)12-16-9-3-1-2-4-15-9/h8-9H,1-7H2,(H,12,13)/t8-,9?,11-/m0/s1 |
| InChIKey | YXTNKCDZHXCGTK-QCZWPSDZSA-N |
| XLogP | 0.60 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|