C11H17Cl2NO2 — CID 7346762
(1S)-2,2-dichloro-1-methyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]cyclopropane-1-carboxamide (PubChem CID 7346762) has the molecular formula C11H17Cl2NO2 and a molecular weight of 266.17 g/mol. Its IUPAC name is (1S)-2,2-dichloro-1-methyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-1-methyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7346762 |
| Molecular Formula | C11H17Cl2NO2 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | (1S)-2,2-dichloro-1-methyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]cyclopropane-1-carboxamide |
| SMILES | C[C@H](NC(=O)[C@]1(C)CC1(Cl)Cl)[C@@H]1CCCO1 |
| InChI | InChI=1S/C11H17Cl2NO2/c1-7(8-4-3-5-16-8)14-9(15)10(2)6-11(10,12)13/h7-8H,3-6H2,1-2H3,(H,14,15)/t7-,8-,10-/m0/s1 |
| InChIKey | PPLAIDAIRDXTTH-NRPADANISA-N |
| XLogP | 2.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|