C15H27N3O4 — CID 94824519
(3R)-3-N-[(2S)-oxan-2-yl]oxy-1-N-propan-2-ylpiperidine-1,3-dicarboxamide (PubChem CID 94824519) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is (3R)-3-N-[(2S)-oxan-2-yl]oxy-1-N-propan-2-ylpiperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[(2S)-oxan-2-yl]oxy-1-N-propan-2-ylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 94824519 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (3R)-3-N-[(2S)-oxan-2-yl]oxy-1-N-propan-2-ylpiperidine-1,3-dicarboxamide |
| SMILES | CC(C)NC(=O)N1CCC[C@@H](C(=O)NO[C@H]2CCCCO2)C1 |
| InChI | InChI=1S/C15H27N3O4/c1-11(2)16-15(20)18-8-5-6-12(10-18)14(19)17-22-13-7-3-4-9-21-13/h11-13H,3-10H2,1-2H3,(H,16,20)(H,17,19)/t12-,13+/m1/s1 |
| InChIKey | XETZTBPELJZHSA-OLZOCXBDSA-N |
| XLogP | 1.39 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|