C15H19NO5 — CID 170777342
(4R)-4-hydroxy-N-(oxan-2-yloxy)-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 170777342) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is (4R)-4-hydroxy-N-(oxan-2-yloxy)-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (4R)-4-hydroxy-N-(oxan-2-yloxy)-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 170777342 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (4R)-4-hydroxy-N-(oxan-2-yloxy)-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1C[C@@H](O)c2ccccc2O1 |
| InChI | InChI=1S/C15H19NO5/c17-11-9-13(20-12-6-2-1-5-10(11)12)15(18)16-21-14-7-3-4-8-19-14/h1-2,5-6,11,13-14,17H,3-4,7-9H2,(H,16,18)/t11-,13?,14?/m1/s1 |
| InChIKey | LKTJRXNWIGPAFP-LMWSTFAQSA-N |
| XLogP | 1.45 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|