C23H26N2O5 — CID 97106758
9H-fluoren-9-ylmethyl (2R)-2-amino-4-[[(2S)-oxan-2-yl]oxyamino]-4-oxobutanoate (PubChem CID 97106758) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2R)-2-amino-4-[[(2S)-oxan-2-yl]oxyamino]-4-oxobutanoate.
| Compound Name | 9H-fluoren-9-ylmethyl (2R)-2-amino-4-[[(2S)-oxan-2-yl]oxyamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 97106758 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2R)-2-amino-4-[[(2S)-oxan-2-yl]oxyamino]-4-oxobutanoate |
| SMILES | N[C@H](CC(=O)NO[C@H]1CCCCO1)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H26N2O5/c24-20(13-21(26)25-30-22-11-5-6-12-28-22)23(27)29-14-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-4,7-10,19-20,22H,5-6,11-14,24H2,(H,25,26)/t20-,22+/m1/s1 |
| InChIKey | SBLMKIJYZZPZJY-IRLDBZIGSA-N |
| XLogP | 2.63 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|