C31H33BrN2O7S2 — CID 23401999
9H-fluoren-9-ylmethyl (7S)-7-(5-bromothiophen-2-yl)-7-[2-(oxan-2-yloxyamino)-2-oxoethyl]-1,1-dioxo-1,4-thiazepane-4-carboxylate (PubChem CID 23401999) has the molecular formula C31H33BrN2O7S2 and a molecular weight of 689.65 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (7S)-7-(5-bromothiophen-2-yl)-7-[2-(oxan-2-yloxyamino)-2-oxoethyl]-1,1-dioxo-1,4-thiazepane-4-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (7S)-7-(5-bromothiophen-2-yl)-7-[2-(oxan-2-yloxyamino)-2-oxoethyl]-1,1-dioxo-1,4-thiazepane-4-carboxylate |
|---|---|
| PubChem CID | 23401999 |
| Molecular Formula | C31H33BrN2O7S2 |
| Molecular Weight | 689.65 g/mol |
| Exact Mass | 688.09 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (7S)-7-(5-bromothiophen-2-yl)-7-[2-(oxan-2-yloxyamino)-2-oxoethyl]-1,1-dioxo-1,4-thiazepane-4-carboxylate |
| SMILES | O=C(C[C@]1(c2ccc(Br)s2)CCN(C(=O)OCC2c3ccccc3-c3ccccc32)CCS1(=O)=O)NOC1CCCCO1 |
| InChI | InChI=1S/C31H33BrN2O7S2/c32-27-13-12-26(42-27)31(19-28(35)33-41-29-11-5-6-17-39-29)14-15-34(16-18-43(31,37)38)30(36)40-20-25-23-9-3-1-7-21(23)22-8-2-4-10-24(22)25/h1-4,7-10,12-13,25,29H,5-6,11,14-20H2,(H,33,35)/t29?,31-/m0/s1 |
| InChIKey | WUUGOODOVNWELY-RDFOUATCSA-N |
| XLogP | 5.74 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.65 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|