C24H28BrClN2O7S2 — CID 22276974
2-[7-(5-bromothiophen-2-yl)-4-(4-chloro-2-methoxybenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 22276974) has the molecular formula C24H28BrClN2O7S2 and a molecular weight of 635.99 g/mol. Its IUPAC name is 2-[7-(5-bromothiophen-2-yl)-4-(4-chloro-2-methoxybenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[7-(5-bromothiophen-2-yl)-4-(4-chloro-2-methoxybenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 22276974 |
| Molecular Formula | C24H28BrClN2O7S2 |
| Molecular Weight | 635.99 g/mol |
| Exact Mass | 634.02 |
| IUPAC Name | 2-[7-(5-bromothiophen-2-yl)-4-(4-chloro-2-methoxybenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | COc1cc(Cl)ccc1C(=O)N1CCC(CC(=O)NOC2CCCCO2)(c2ccc(Br)s2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C24H28BrClN2O7S2/c1-33-18-14-16(26)5-6-17(18)23(30)28-10-9-24(37(31,32)13-11-28,19-7-8-20(25)36-19)15-21(29)27-35-22-4-2-3-12-34-22/h5-8,14,22H,2-4,9-13,15H2,1H3,(H,27,29) |
| InChIKey | OYHAOVFRUXLCAY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.99 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|