C29H32N4O7S — CID 22276651
2-[1,1-dioxo-7-(4-phenoxyphenyl)-4-(pyrazine-2-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 22276651) has the molecular formula C29H32N4O7S and a molecular weight of 580.66 g/mol. Its IUPAC name is 2-[1,1-dioxo-7-(4-phenoxyphenyl)-4-(pyrazine-2-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[1,1-dioxo-7-(4-phenoxyphenyl)-4-(pyrazine-2-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 22276651 |
| Molecular Formula | C29H32N4O7S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 2-[1,1-dioxo-7-(4-phenoxyphenyl)-4-(pyrazine-2-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | O=C(CC1(c2ccc(Oc3ccccc3)cc2)CCN(C(=O)c2cnccn2)CCS1(=O)=O)NOC1CCCCO1 |
| InChI | InChI=1S/C29H32N4O7S/c34-26(32-40-27-8-4-5-18-38-27)20-29(22-9-11-24(12-10-22)39-23-6-2-1-3-7-23)13-16-33(17-19-41(29,36)37)28(35)25-21-30-14-15-31-25/h1-3,6-7,9-12,14-15,21,27H,4-5,8,13,16-20H2,(H,32,34) |
| InChIKey | HZFYCHCTOTUHOI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|