C30H34N2O6S2 — CID 23402027
2-[(7S)-4-benzoyl-7-[5-(4-methylphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 23402027) has the molecular formula C30H34N2O6S2 and a molecular weight of 582.74 g/mol. Its IUPAC name is 2-[(7S)-4-benzoyl-7-[5-(4-methylphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(7S)-4-benzoyl-7-[5-(4-methylphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 23402027 |
| Molecular Formula | C30H34N2O6S2 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 2-[(7S)-4-benzoyl-7-[5-(4-methylphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | Cc1ccc(-c2ccc([C@@]3(CC(=O)NOC4CCCCO4)CCN(C(=O)c4ccccc4)CCS3(=O)=O)s2)cc1 |
| InChI | InChI=1S/C30H34N2O6S2/c1-22-10-12-23(13-11-22)25-14-15-26(39-25)30(21-27(33)31-38-28-9-5-6-19-37-28)16-17-32(18-20-40(30,35)36)29(34)24-7-3-2-4-8-24/h2-4,7-8,10-15,28H,5-6,9,16-21H2,1H3,(H,31,33)/t28?,30-/m0/s1 |
| InChIKey | YUVNASJFOFKOLO-TXDWVUBVSA-N |
| XLogP | 4.84 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|