C22H26BrN3O6S2 — CID 22277034
2-[7-(5-bromothiophen-2-yl)-1,1-dioxo-4-(pyridine-3-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 22277034) has the molecular formula C22H26BrN3O6S2 and a molecular weight of 572.50 g/mol. Its IUPAC name is 2-[7-(5-bromothiophen-2-yl)-1,1-dioxo-4-(pyridine-3-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[7-(5-bromothiophen-2-yl)-1,1-dioxo-4-(pyridine-3-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 22277034 |
| Molecular Formula | C22H26BrN3O6S2 |
| Molecular Weight | 572.50 g/mol |
| Exact Mass | 571.04 |
| IUPAC Name | 2-[7-(5-bromothiophen-2-yl)-1,1-dioxo-4-(pyridine-3-carbonyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | O=C(CC1(c2ccc(Br)s2)CCN(C(=O)c2cccnc2)CCS1(=O)=O)NOC1CCCCO1 |
| InChI | InChI=1S/C22H26BrN3O6S2/c23-18-7-6-17(33-18)22(14-19(27)25-32-20-5-1-2-12-31-20)8-10-26(11-13-34(22,29)30)21(28)16-4-3-9-24-15-16/h3-4,6-7,9,15,20H,1-2,5,8,10-14H2,(H,25,27) |
| InChIKey | XVKINIXXTQFBGS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|