C21H22N4O5S3 — CID 87977935
N-hydroxy-2-[7-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,1-dioxo-4-(pyrazine-2-carbonyl)-1,4-thiazepan-7-yl]acetamide (PubChem CID 87977935) has the molecular formula C21H22N4O5S3 and a molecular weight of 506.63 g/mol. Its IUPAC name is N-hydroxy-2-[7-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,1-dioxo-4-(pyrazine-2-carbonyl)-1,4-thiazepan-7-yl]acetamide.
| Compound Name | N-hydroxy-2-[7-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,1-dioxo-4-(pyrazine-2-carbonyl)-1,4-thiazepan-7-yl]acetamide |
|---|---|
| PubChem CID | 87977935 |
| Molecular Formula | C21H22N4O5S3 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | N-hydroxy-2-[7-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,1-dioxo-4-(pyrazine-2-carbonyl)-1,4-thiazepan-7-yl]acetamide |
| SMILES | Cc1csc(-c2ccc(C3(CC(=O)NO)CCN(C(=O)c4cnccn4)CCS3(=O)=O)s2)c1 |
| InChI | InChI=1S/C21H22N4O5S3/c1-14-10-17(31-13-14)16-2-3-18(32-16)21(11-19(26)24-28)4-7-25(8-9-33(21,29)30)20(27)15-12-22-5-6-23-15/h2-3,5-6,10,12-13,28H,4,7-9,11H2,1H3,(H,24,26) |
| InChIKey | DZKNOBHQJSWEHF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|