C29H31ClN2O6S2 — CID 10167658
2-[4-benzoyl-7-[5-(4-chlorophenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 10167658) has the molecular formula C29H31ClN2O6S2 and a molecular weight of 603.16 g/mol. Its IUPAC name is 2-[4-benzoyl-7-[5-(4-chlorophenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[4-benzoyl-7-[5-(4-chlorophenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 10167658 |
| Molecular Formula | C29H31ClN2O6S2 |
| Molecular Weight | 603.16 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 2-[4-benzoyl-7-[5-(4-chlorophenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | O=C(CC1(c2ccc(-c3ccc(Cl)cc3)s2)CCN(C(=O)c2ccccc2)CCS1(=O)=O)NOC1CCCCO1 |
| InChI | InChI=1S/C29H31ClN2O6S2/c30-23-11-9-21(10-12-23)24-13-14-25(39-24)29(20-26(33)31-38-27-8-4-5-18-37-27)15-16-32(17-19-40(29,35)36)28(34)22-6-2-1-3-7-22/h1-3,6-7,9-14,27H,4-5,8,15-20H2,(H,31,33) |
| InChIKey | DZLHFMJAONNAGU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.16 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|