C23H29FN2O7S3 — CID 22276686
2-[7-[5-(4-fluorophenyl)thiophen-2-yl]-4-methylsulfonyl-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 22276686) has the molecular formula C23H29FN2O7S3 and a molecular weight of 560.69 g/mol. Its IUPAC name is 2-[7-[5-(4-fluorophenyl)thiophen-2-yl]-4-methylsulfonyl-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[7-[5-(4-fluorophenyl)thiophen-2-yl]-4-methylsulfonyl-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 22276686 |
| Molecular Formula | C23H29FN2O7S3 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 2-[7-[5-(4-fluorophenyl)thiophen-2-yl]-4-methylsulfonyl-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | CS(=O)(=O)N1CCC(CC(=O)NOC2CCCCO2)(c2ccc(-c3ccc(F)cc3)s2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C23H29FN2O7S3/c1-35(28,29)26-12-11-23(36(30,31)15-13-26,16-21(27)25-33-22-4-2-3-14-32-22)20-10-9-19(34-20)17-5-7-18(24)8-6-17/h5-10,22H,2-4,11-16H2,1H3,(H,25,27) |
| InChIKey | GGMMBGVTJURGIR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|