C16H23BrN2O5S2 — CID 23402080
2-[(7S)-7-(5-bromothiophen-2-yl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 23402080) has the molecular formula C16H23BrN2O5S2 and a molecular weight of 467.41 g/mol. Its IUPAC name is 2-[(7S)-7-(5-bromothiophen-2-yl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(7S)-7-(5-bromothiophen-2-yl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 23402080 |
| Molecular Formula | C16H23BrN2O5S2 |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 2-[(7S)-7-(5-bromothiophen-2-yl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | O=C(C[C@]1(c2ccc(Br)s2)CCNCCS1(=O)=O)NOC1CCCCO1 |
| InChI | InChI=1S/C16H23BrN2O5S2/c17-13-5-4-12(25-13)16(6-7-18-8-10-26(16,21)22)11-14(20)19-24-15-3-1-2-9-23-15/h4-5,15,18H,1-3,6-11H2,(H,19,20)/t15?,16-/m0/s1 |
| InChIKey | HVBCHVLCYGWLBP-LYKKTTPLSA-N |
| XLogP | 2.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|