C23H28BrN3O6S2 — CID 22276855
2-[7-(5-bromothiophen-2-yl)-1,1-dioxo-4-(2-pyridin-3-ylacetyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 22276855) has the molecular formula C23H28BrN3O6S2 and a molecular weight of 586.53 g/mol. Its IUPAC name is 2-[7-(5-bromothiophen-2-yl)-1,1-dioxo-4-(2-pyridin-3-ylacetyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[7-(5-bromothiophen-2-yl)-1,1-dioxo-4-(2-pyridin-3-ylacetyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 22276855 |
| Molecular Formula | C23H28BrN3O6S2 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 585.06 |
| IUPAC Name | 2-[7-(5-bromothiophen-2-yl)-1,1-dioxo-4-(2-pyridin-3-ylacetyl)-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | O=C(CC1(c2ccc(Br)s2)CCN(C(=O)Cc2cccnc2)CCS1(=O)=O)NOC1CCCCO1 |
| InChI | InChI=1S/C23H28BrN3O6S2/c24-19-7-6-18(34-19)23(15-20(28)26-33-22-5-1-2-12-32-22)8-10-27(11-13-35(23,30)31)21(29)14-17-4-3-9-25-16-17/h3-4,6-7,9,16,22H,1-2,5,8,10-15H2,(H,26,28) |
| InChIKey | WKUACXOYVNNGNZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|