C24H29BrN2O6S2 — CID 22276521
2-[7-(5-bromothiophen-2-yl)-4-(2-methylbenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 22276521) has the molecular formula C24H29BrN2O6S2 and a molecular weight of 585.54 g/mol. Its IUPAC name is 2-[7-(5-bromothiophen-2-yl)-4-(2-methylbenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[7-(5-bromothiophen-2-yl)-4-(2-methylbenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 22276521 |
| Molecular Formula | C24H29BrN2O6S2 |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | 2-[7-(5-bromothiophen-2-yl)-4-(2-methylbenzoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | Cc1ccccc1C(=O)N1CCC(CC(=O)NOC2CCCCO2)(c2ccc(Br)s2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C24H29BrN2O6S2/c1-17-6-2-3-7-18(17)23(29)27-12-11-24(35(30,31)15-13-27,19-9-10-20(25)34-19)16-21(28)26-33-22-8-4-5-14-32-22/h2-3,6-7,9-10,22H,4-5,8,11-16H2,1H3,(H,26,28) |
| InChIKey | ZICPVFIHZULNDO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|