C26H32N2O7S — CID 22277116
2-[4-benzoyl-7-(4-methoxyphenyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 22277116) has the molecular formula C26H32N2O7S and a molecular weight of 516.62 g/mol. Its IUPAC name is 2-[4-benzoyl-7-(4-methoxyphenyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[4-benzoyl-7-(4-methoxyphenyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 22277116 |
| Molecular Formula | C26H32N2O7S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 2-[4-benzoyl-7-(4-methoxyphenyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | COc1ccc(C2(CC(=O)NOC3CCCCO3)CCN(C(=O)c3ccccc3)CCS2(=O)=O)cc1 |
| InChI | InChI=1S/C26H32N2O7S/c1-33-22-12-10-21(11-13-22)26(19-23(29)27-35-24-9-5-6-17-34-24)14-15-28(16-18-36(26,31)32)25(30)20-7-3-2-4-8-20/h2-4,7-8,10-13,24H,5-6,9,14-19H2,1H3,(H,27,29) |
| InChIKey | LXSRBSLMNLPLHC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|